About 5-ethenyl-3-ethyl-2-methylpyridine;methane;pyridine
5-ethenyl-3-ethyl-2-methylpyridine;methane;pyridine (PubChem CID 174840811) has the molecular formula C16H22N2
and a molecular weight of 242.37 g/mol. Its IUPAC name is 5-ethenyl-3-ethyl-2-methylpyridine;methane;pyridine.
Molecular Properties
| Compound Name | 5-ethenyl-3-ethyl-2-methylpyridine;methane;pyridine |
| PubChem CID | 174840811 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 5-ethenyl-3-ethyl-2-methylpyridine;methane;pyridine |
| SMILES | C.C=Cc1cnc(C)c(CC)c1.c1ccncc1 |
| InChI | InChI=1S/C10H13N.C5H5N.CH4/c1-4-9-6-10(5-2)8(3)11-7-9;1-2-4-6-5-3-1;/h4,6-7H,1,5H2,2-3H3;1-5H;1H4 |
| InChIKey | WHCGKXDVRWSWKB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethenyl-3-ethyl-2-methylpyridine;methane;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-3-ethyl-2-methylpyridine;methane;pyridine?
The IUPAC name of 5-ethenyl-3-ethyl-2-methylpyridine;methane;pyridine (CID 174840811) is 5-ethenyl-3-ethyl-2-methylpyridine;methane;pyridine.
What is the SMILES notation for 5-ethenyl-3-ethyl-2-methylpyridine;methane;pyridine?
The canonical SMILES for 5-ethenyl-3-ethyl-2-methylpyridine;methane;pyridine is C.C=Cc1cnc(C)c(CC)c1.c1ccncc1.
What is the InChIKey of 5-ethenyl-3-ethyl-2-methylpyridine;methane;pyridine?
The InChIKey is WHCGKXDVRWSWKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N.C5H5N.CH4/c1-4-9-6-10(5-2)8(3)11-7-9;1-2-4-6-5-3-1;/h4,6-7H,1,5H2,2-3H3;1-5H;1H4.
What are the key properties of 5-ethenyl-3-ethyl-2-methylpyridine;methane;pyridine?
5-ethenyl-3-ethyl-2-methylpyridine;methane;pyridine has a molecular weight of 242.37 g/mol, XLogP of 4.31, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-3-ethyl-2-methylpyridine;methane;pyridine is sourced from PubChem (CID 174840811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).