About 5-chloro-2-methyl-2H-1,3-oxazole-3-carbaldehyde
5-chloro-2-methyl-2H-1,3-oxazole-3-carbaldehyde (PubChem CID 174840967) has the molecular formula C5H6ClNO2
and a molecular weight of 147.56 g/mol. Its IUPAC name is 5-chloro-2-methyl-2H-1,3-oxazole-3-carbaldehyde.
Molecular Properties
| Compound Name | 5-chloro-2-methyl-2H-1,3-oxazole-3-carbaldehyde |
| PubChem CID | 174840967 |
| Molecular Formula | C5H6ClNO2 |
| Molecular Weight | 147.56 g/mol |
| Exact Mass | 147.01 |
| IUPAC Name | 5-chloro-2-methyl-2H-1,3-oxazole-3-carbaldehyde |
| SMILES | CC1OC(Cl)=CN1C=O |
| InChI | InChI=1S/C5H6ClNO2/c1-4-7(3-8)2-5(6)9-4/h2-4H,1H3 |
| InChIKey | HNDQUTIECPAYJJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.56 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-methyl-2H-1,3-oxazole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-methyl-2H-1,3-oxazole-3-carbaldehyde?
The IUPAC name of 5-chloro-2-methyl-2H-1,3-oxazole-3-carbaldehyde (CID 174840967) is 5-chloro-2-methyl-2H-1,3-oxazole-3-carbaldehyde.
What is the SMILES notation for 5-chloro-2-methyl-2H-1,3-oxazole-3-carbaldehyde?
The canonical SMILES for 5-chloro-2-methyl-2H-1,3-oxazole-3-carbaldehyde is CC1OC(Cl)=CN1C=O.
What is the InChIKey of 5-chloro-2-methyl-2H-1,3-oxazole-3-carbaldehyde?
The InChIKey is HNDQUTIECPAYJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6ClNO2/c1-4-7(3-8)2-5(6)9-4/h2-4H,1H3.
What are the key properties of 5-chloro-2-methyl-2H-1,3-oxazole-3-carbaldehyde?
5-chloro-2-methyl-2H-1,3-oxazole-3-carbaldehyde has a molecular weight of 147.56 g/mol, XLogP of 0.86, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-methyl-2H-1,3-oxazole-3-carbaldehyde is sourced from PubChem (CID 174840967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).