C10H16N2O2 — CID 174840987
2,3-bis(2-methoxyethyl)pyrazine (PubChem CID 174840987) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 2,3-bis(2-methoxyethyl)pyrazine.
| Compound Name | 2,3-bis(2-methoxyethyl)pyrazine |
|---|---|
| PubChem CID | 174840987 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 2,3-bis(2-methoxyethyl)pyrazine |
| SMILES | COCCc1nccnc1CCOC |
| InChI | InChI=1S/C10H16N2O2/c1-13-7-3-9-10(4-8-14-2)12-6-5-11-9/h5-6H,3-4,7-8H2,1-2H3 |
| InChIKey | FGGSWGYOVKAICL-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |