About bromo 1,3-thiazole-4-carboxylate
bromo 1,3-thiazole-4-carboxylate (PubChem CID 174841032) has the molecular formula C4H2BrNO2S
and a molecular weight of 208.04 g/mol. Its IUPAC name is bromo 1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | bromo 1,3-thiazole-4-carboxylate |
| PubChem CID | 174841032 |
| Molecular Formula | C4H2BrNO2S |
| Molecular Weight | 208.04 g/mol |
| Exact Mass | 206.90 |
| IUPAC Name | bromo 1,3-thiazole-4-carboxylate |
| SMILES | O=C(OBr)c1cscn1 |
| InChI | InChI=1S/C4H2BrNO2S/c5-8-4(7)3-1-9-2-6-3/h1-2H |
| InChIKey | GVFJZNNCPJNIAY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.04 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bromo 1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromo 1,3-thiazole-4-carboxylate?
The IUPAC name of bromo 1,3-thiazole-4-carboxylate (CID 174841032) is bromo 1,3-thiazole-4-carboxylate.
What is the SMILES notation for bromo 1,3-thiazole-4-carboxylate?
The canonical SMILES for bromo 1,3-thiazole-4-carboxylate is O=C(OBr)c1cscn1.
What is the InChIKey of bromo 1,3-thiazole-4-carboxylate?
The InChIKey is GVFJZNNCPJNIAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2BrNO2S/c5-8-4(7)3-1-9-2-6-3/h1-2H.
What are the key properties of bromo 1,3-thiazole-4-carboxylate?
bromo 1,3-thiazole-4-carboxylate has a molecular weight of 208.04 g/mol, XLogP of 1.61, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bromo 1,3-thiazole-4-carboxylate is sourced from PubChem (CID 174841032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).