About 1-bromopropan-2-ol;hydrochloride
1-bromopropan-2-ol;hydrochloride (PubChem CID 174841035) has the molecular formula C3H8BrClO
and a molecular weight of 175.45 g/mol. Its IUPAC name is 1-bromopropan-2-ol;hydrochloride.
Molecular Properties
| Compound Name | 1-bromopropan-2-ol;hydrochloride |
| PubChem CID | 174841035 |
| Molecular Formula | C3H8BrClO |
| Molecular Weight | 175.45 g/mol |
| Exact Mass | 173.94 |
| IUPAC Name | 1-bromopropan-2-ol;hydrochloride |
| SMILES | CC(O)CBr.Cl |
| InChI | InChI=1S/C3H7BrO.ClH/c1-3(5)2-4;/h3,5H,2H2,1H3;1H |
| InChIKey | PYHZKAVSQPNGCH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.45 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromopropan-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromopropan-2-ol;hydrochloride?
The IUPAC name of 1-bromopropan-2-ol;hydrochloride (CID 174841035) is 1-bromopropan-2-ol;hydrochloride.
What is the SMILES notation for 1-bromopropan-2-ol;hydrochloride?
The canonical SMILES for 1-bromopropan-2-ol;hydrochloride is CC(O)CBr.Cl.
What is the InChIKey of 1-bromopropan-2-ol;hydrochloride?
The InChIKey is PYHZKAVSQPNGCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7BrO.ClH/c1-3(5)2-4;/h3,5H,2H2,1H3;1H.
What are the key properties of 1-bromopropan-2-ol;hydrochloride?
1-bromopropan-2-ol;hydrochloride has a molecular weight of 175.45 g/mol, XLogP of 1.18, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromopropan-2-ol;hydrochloride is sourced from PubChem (CID 174841035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).