About 2-(1,3-oxazol-2-yltetrasulfanyl)-1,3-oxazole;thiophene
2-(1,3-oxazol-2-yltetrasulfanyl)-1,3-oxazole;thiophene (PubChem CID 174841150) has the molecular formula C10H8N2O2S5
and a molecular weight of 348.52 g/mol. Its IUPAC name is 2-(1,3-oxazol-2-yltetrasulfanyl)-1,3-oxazole;thiophene.
Molecular Properties
| Compound Name | 2-(1,3-oxazol-2-yltetrasulfanyl)-1,3-oxazole;thiophene |
| PubChem CID | 174841150 |
| Molecular Formula | C10H8N2O2S5 |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 347.92 |
| IUPAC Name | 2-(1,3-oxazol-2-yltetrasulfanyl)-1,3-oxazole;thiophene |
| SMILES | c1ccsc1.c1coc(SSSSc2ncco2)n1 |
| InChI | InChI=1S/C6H4N2O2S4.C4H4S/c1-3-9-5(7-1)11-13-14-12-6-8-2-4-10-6;1-2-4-5-3-1/h1-4H;1-4H |
| InChIKey | DTXYHYPRWMYWSV-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-oxazol-2-yltetrasulfanyl)-1,3-oxazole;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-oxazol-2-yltetrasulfanyl)-1,3-oxazole;thiophene?
The IUPAC name of 2-(1,3-oxazol-2-yltetrasulfanyl)-1,3-oxazole;thiophene (CID 174841150) is 2-(1,3-oxazol-2-yltetrasulfanyl)-1,3-oxazole;thiophene.
What is the SMILES notation for 2-(1,3-oxazol-2-yltetrasulfanyl)-1,3-oxazole;thiophene?
The canonical SMILES for 2-(1,3-oxazol-2-yltetrasulfanyl)-1,3-oxazole;thiophene is c1ccsc1.c1coc(SSSSc2ncco2)n1.
What is the InChIKey of 2-(1,3-oxazol-2-yltetrasulfanyl)-1,3-oxazole;thiophene?
The InChIKey is DTXYHYPRWMYWSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O2S4.C4H4S/c1-3-9-5(7-1)11-13-14-12-6-8-2-4-10-6;1-2-4-5-3-1/h1-4H;1-4H.
What are the key properties of 2-(1,3-oxazol-2-yltetrasulfanyl)-1,3-oxazole;thiophene?
2-(1,3-oxazol-2-yltetrasulfanyl)-1,3-oxazole;thiophene has a molecular weight of 348.52 g/mol, XLogP of 5.51, 5 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-oxazol-2-yltetrasulfanyl)-1,3-oxazole;thiophene is sourced from PubChem (CID 174841150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).