About 2-hydroxy-4-oxo-4-sulfanylbutanethioate;molybdenum
2-hydroxy-4-oxo-4-sulfanylbutanethioate;molybdenum (PubChem CID 174841445) has the molecular formula C4H5MoO3S2-
and a molecular weight of 261.16 g/mol. Its IUPAC name is 2-hydroxy-4-oxo-4-sulfanylbutanethioate;molybdenum.
Molecular Properties
| Compound Name | 2-hydroxy-4-oxo-4-sulfanylbutanethioate;molybdenum |
| PubChem CID | 174841445 |
| Molecular Formula | C4H5MoO3S2- |
| Molecular Weight | 261.16 g/mol |
| Exact Mass | 262.87 |
| IUPAC Name | 2-hydroxy-4-oxo-4-sulfanylbutanethioate;molybdenum |
| SMILES | O=C(S)CC(O)C(=O)[S-].[Mo] |
| InChI | InChI=1S/C4H6O3S2.Mo/c5-2(4(7)9)1-3(6)8;/h2,5H,1H2,(H,6,8)(H,7,9);/p-1 |
| InChIKey | SIULFFQEZKHEAN-UHFFFAOYSA-M |
| XLogP | -0.74 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.16 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-4-oxo-4-sulfanylbutanethioate;molybdenum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-4-oxo-4-sulfanylbutanethioate;molybdenum?
The IUPAC name of 2-hydroxy-4-oxo-4-sulfanylbutanethioate;molybdenum (CID 174841445) is 2-hydroxy-4-oxo-4-sulfanylbutanethioate;molybdenum.
What is the SMILES notation for 2-hydroxy-4-oxo-4-sulfanylbutanethioate;molybdenum?
The canonical SMILES for 2-hydroxy-4-oxo-4-sulfanylbutanethioate;molybdenum is O=C(S)CC(O)C(=O)[S-].[Mo].
What is the InChIKey of 2-hydroxy-4-oxo-4-sulfanylbutanethioate;molybdenum?
The InChIKey is SIULFFQEZKHEAN-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H6O3S2.Mo/c5-2(4(7)9)1-3(6)8;/h2,5H,1H2,(H,6,8)(H,7,9);/p-1.
What are the key properties of 2-hydroxy-4-oxo-4-sulfanylbutanethioate;molybdenum?
2-hydroxy-4-oxo-4-sulfanylbutanethioate;molybdenum has a molecular weight of 261.16 g/mol, XLogP of -0.74, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-4-oxo-4-sulfanylbutanethioate;molybdenum is sourced from PubChem (CID 174841445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).