About 2-(cyclohepten-1-yl)-4,5-dihydro-1,3-thiazole
2-(cyclohepten-1-yl)-4,5-dihydro-1,3-thiazole (PubChem CID 174841609) has the molecular formula C10H15NS
and a molecular weight of 181.30 g/mol. Its IUPAC name is 2-(cyclohepten-1-yl)-4,5-dihydro-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(cyclohepten-1-yl)-4,5-dihydro-1,3-thiazole |
| PubChem CID | 174841609 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 2-(cyclohepten-1-yl)-4,5-dihydro-1,3-thiazole |
| SMILES | C1=C(C2=NCCS2)CCCCC1 |
| InChI | InChI=1S/C10H15NS/c1-2-4-6-9(5-3-1)10-11-7-8-12-10/h5H,1-4,6-8H2 |
| InChIKey | AIIWTDQKWPIPRT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(cyclohepten-1-yl)-4,5-dihydro-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohepten-1-yl)-4,5-dihydro-1,3-thiazole?
The IUPAC name of 2-(cyclohepten-1-yl)-4,5-dihydro-1,3-thiazole (CID 174841609) is 2-(cyclohepten-1-yl)-4,5-dihydro-1,3-thiazole.
What is the SMILES notation for 2-(cyclohepten-1-yl)-4,5-dihydro-1,3-thiazole?
The canonical SMILES for 2-(cyclohepten-1-yl)-4,5-dihydro-1,3-thiazole is C1=C(C2=NCCS2)CCCCC1.
What is the InChIKey of 2-(cyclohepten-1-yl)-4,5-dihydro-1,3-thiazole?
The InChIKey is AIIWTDQKWPIPRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NS/c1-2-4-6-9(5-3-1)10-11-7-8-12-10/h5H,1-4,6-8H2.
What are the key properties of 2-(cyclohepten-1-yl)-4,5-dihydro-1,3-thiazole?
2-(cyclohepten-1-yl)-4,5-dihydro-1,3-thiazole has a molecular weight of 181.30 g/mol, XLogP of 3.02, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohepten-1-yl)-4,5-dihydro-1,3-thiazole is sourced from PubChem (CID 174841609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).