About 1-piperidin-1-ylcyclohexa-2,4-diene-1-carbaldehyde
1-piperidin-1-ylcyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 174841682) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 1-piperidin-1-ylcyclohexa-2,4-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 1-piperidin-1-ylcyclohexa-2,4-diene-1-carbaldehyde |
| PubChem CID | 174841682 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 1-piperidin-1-ylcyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | O=CC1(N2CCCCC2)C=CC=CC1 |
| InChI | InChI=1S/C12H17NO/c14-11-12(7-3-1-4-8-12)13-9-5-2-6-10-13/h1,3-4,7,11H,2,5-6,8-10H2 |
| InChIKey | AEKWDJPJQJGRCN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-piperidin-1-ylcyclohexa-2,4-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperidin-1-ylcyclohexa-2,4-diene-1-carbaldehyde?
The IUPAC name of 1-piperidin-1-ylcyclohexa-2,4-diene-1-carbaldehyde (CID 174841682) is 1-piperidin-1-ylcyclohexa-2,4-diene-1-carbaldehyde.
What is the SMILES notation for 1-piperidin-1-ylcyclohexa-2,4-diene-1-carbaldehyde?
The canonical SMILES for 1-piperidin-1-ylcyclohexa-2,4-diene-1-carbaldehyde is O=CC1(N2CCCCC2)C=CC=CC1.
What is the InChIKey of 1-piperidin-1-ylcyclohexa-2,4-diene-1-carbaldehyde?
The InChIKey is AEKWDJPJQJGRCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c14-11-12(7-3-1-4-8-12)13-9-5-2-6-10-13/h1,3-4,7,11H,2,5-6,8-10H2.
What are the key properties of 1-piperidin-1-ylcyclohexa-2,4-diene-1-carbaldehyde?
1-piperidin-1-ylcyclohexa-2,4-diene-1-carbaldehyde has a molecular weight of 191.27 g/mol, XLogP of 1.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperidin-1-ylcyclohexa-2,4-diene-1-carbaldehyde is sourced from PubChem (CID 174841682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).