About N-propylcyclohexanamine;2,2,2-trifluoroacetic acid
N-propylcyclohexanamine;2,2,2-trifluoroacetic acid (PubChem CID 174842081) has the molecular formula C11H20F3NO2
and a molecular weight of 255.28 g/mol. Its IUPAC name is N-propylcyclohexanamine;2,2,2-trifluoroacetic acid.
Molecular Properties
| Compound Name | N-propylcyclohexanamine;2,2,2-trifluoroacetic acid |
| PubChem CID | 174842081 |
| Molecular Formula | C11H20F3NO2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N-propylcyclohexanamine;2,2,2-trifluoroacetic acid |
| SMILES | CCCNC1CCCCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H19N.C2HF3O2/c1-2-8-10-9-6-4-3-5-7-9;3-2(4,5)1(6)7/h9-10H,2-8H2,1H3;(H,6,7) |
| InChIKey | CKOSCXPPJHOVJW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-propylcyclohexanamine;2,2,2-trifluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propylcyclohexanamine;2,2,2-trifluoroacetic acid?
The IUPAC name of N-propylcyclohexanamine;2,2,2-trifluoroacetic acid (CID 174842081) is N-propylcyclohexanamine;2,2,2-trifluoroacetic acid.
What is the SMILES notation for N-propylcyclohexanamine;2,2,2-trifluoroacetic acid?
The canonical SMILES for N-propylcyclohexanamine;2,2,2-trifluoroacetic acid is CCCNC1CCCCC1.O=C(O)C(F)(F)F.
What is the InChIKey of N-propylcyclohexanamine;2,2,2-trifluoroacetic acid?
The InChIKey is CKOSCXPPJHOVJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.C2HF3O2/c1-2-8-10-9-6-4-3-5-7-9;3-2(4,5)1(6)7/h9-10H,2-8H2,1H3;(H,6,7).
What are the key properties of N-propylcyclohexanamine;2,2,2-trifluoroacetic acid?
N-propylcyclohexanamine;2,2,2-trifluoroacetic acid has a molecular weight of 255.28 g/mol, XLogP of 2.95, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-propylcyclohexanamine;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 174842081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).