About (2-butylphenyl)-(4-hydroxy-3,5-diiodophenyl)methanone
(2-butylphenyl)-(4-hydroxy-3,5-diiodophenyl)methanone (PubChem CID 174842319) has the molecular formula C17H16I2O2
and a molecular weight of 506.12 g/mol. Its IUPAC name is (2-butylphenyl)-(4-hydroxy-3,5-diiodophenyl)methanone.
Molecular Properties
| Compound Name | (2-butylphenyl)-(4-hydroxy-3,5-diiodophenyl)methanone |
| PubChem CID | 174842319 |
| Molecular Formula | C17H16I2O2 |
| Molecular Weight | 506.12 g/mol |
| Exact Mass | 505.92 |
| IUPAC Name | (2-butylphenyl)-(4-hydroxy-3,5-diiodophenyl)methanone |
| SMILES | CCCCc1ccccc1C(=O)c1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C17H16I2O2/c1-2-3-6-11-7-4-5-8-13(11)16(20)12-9-14(18)17(21)15(19)10-12/h4-5,7-10,21H,2-3,6H2,1H3 |
| InChIKey | GOBAENBRGMHMDY-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.12 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2-butylphenyl)-(4-hydroxy-3,5-diiodophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-butylphenyl)-(4-hydroxy-3,5-diiodophenyl)methanone?
The IUPAC name of (2-butylphenyl)-(4-hydroxy-3,5-diiodophenyl)methanone (CID 174842319) is (2-butylphenyl)-(4-hydroxy-3,5-diiodophenyl)methanone.
What is the SMILES notation for (2-butylphenyl)-(4-hydroxy-3,5-diiodophenyl)methanone?
The canonical SMILES for (2-butylphenyl)-(4-hydroxy-3,5-diiodophenyl)methanone is CCCCc1ccccc1C(=O)c1cc(I)c(O)c(I)c1.
What is the InChIKey of (2-butylphenyl)-(4-hydroxy-3,5-diiodophenyl)methanone?
The InChIKey is GOBAENBRGMHMDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16I2O2/c1-2-3-6-11-7-4-5-8-13(11)16(20)12-9-14(18)17(21)15(19)10-12/h4-5,7-10,21H,2-3,6H2,1H3.
What are the key properties of (2-butylphenyl)-(4-hydroxy-3,5-diiodophenyl)methanone?
(2-butylphenyl)-(4-hydroxy-3,5-diiodophenyl)methanone has a molecular weight of 506.12 g/mol, XLogP of 5.18, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-butylphenyl)-(4-hydroxy-3,5-diiodophenyl)methanone is sourced from PubChem (CID 174842319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).