C21H25ClN2O4S — CID 17484284
2-chloro-5-morpholin-4-ylsulfonyl-N-(4-phenylbutyl)benzamide (PubChem CID 17484284) has the molecular formula C21H25ClN2O4S and a molecular weight of 436.96 g/mol. Its IUPAC name is 2-chloro-5-morpholin-4-ylsulfonyl-N-(4-phenylbutyl)benzamide.
| Compound Name | 2-chloro-5-morpholin-4-ylsulfonyl-N-(4-phenylbutyl)benzamide |
|---|---|
| PubChem CID | 17484284 |
| Molecular Formula | C21H25ClN2O4S |
| Molecular Weight | 436.96 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 2-chloro-5-morpholin-4-ylsulfonyl-N-(4-phenylbutyl)benzamide |
| SMILES | O=C(NCCCCc1ccccc1)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C21H25ClN2O4S/c22-20-10-9-18(29(26,27)24-12-14-28-15-13-24)16-19(20)21(25)23-11-5-4-8-17-6-2-1-3-7-17/h1-3,6-7,9-10,16H,4-5,8,11-15H2,(H,23,25) |
| InChIKey | SQRMZBCMHLIUMI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.96 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|