About 3,3-dichloropyrrole
3,3-dichloropyrrole (PubChem CID 174843275) has the molecular formula C4H3Cl2N
and a molecular weight of 135.98 g/mol. Its IUPAC name is 3,3-dichloropyrrole.
Molecular Properties
| Compound Name | 3,3-dichloropyrrole |
| PubChem CID | 174843275 |
| Molecular Formula | C4H3Cl2N |
| Molecular Weight | 135.98 g/mol |
| Exact Mass | 134.96 |
| IUPAC Name | 3,3-dichloropyrrole |
| SMILES | ClC1(Cl)C=CN=C1 |
| InChI | InChI=1S/C4H3Cl2N/c5-4(6)1-2-7-3-4/h1-3H |
| InChIKey | KXQMZOASZUMFMP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.98 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dichloropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dichloropyrrole?
The IUPAC name of 3,3-dichloropyrrole (CID 174843275) is 3,3-dichloropyrrole.
What is the SMILES notation for 3,3-dichloropyrrole?
The canonical SMILES for 3,3-dichloropyrrole is ClC1(Cl)C=CN=C1.
What is the InChIKey of 3,3-dichloropyrrole?
The InChIKey is KXQMZOASZUMFMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3Cl2N/c5-4(6)1-2-7-3-4/h1-3H.
What are the key properties of 3,3-dichloropyrrole?
3,3-dichloropyrrole has a molecular weight of 135.98 g/mol, XLogP of 1.76, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dichloropyrrole is sourced from PubChem (CID 174843275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).