About 2-butylcyclohexan-1-one;ethene
2-butylcyclohexan-1-one;ethene (PubChem CID 174843360) has the molecular formula C12H22O
and a molecular weight of 182.31 g/mol. Its IUPAC name is 2-butylcyclohexan-1-one;ethene.
Molecular Properties
| Compound Name | 2-butylcyclohexan-1-one;ethene |
| PubChem CID | 174843360 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 2-butylcyclohexan-1-one;ethene |
| SMILES | C=C.CCCCC1CCCCC1=O |
| InChI | InChI=1S/C10H18O.C2H4/c1-2-3-6-9-7-4-5-8-10(9)11;1-2/h9H,2-8H2,1H3;1-2H2 |
| InChIKey | YJJKCAOXUFMAOA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-butylcyclohexan-1-one;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylcyclohexan-1-one;ethene?
The IUPAC name of 2-butylcyclohexan-1-one;ethene (CID 174843360) is 2-butylcyclohexan-1-one;ethene.
What is the SMILES notation for 2-butylcyclohexan-1-one;ethene?
The canonical SMILES for 2-butylcyclohexan-1-one;ethene is C=C.CCCCC1CCCCC1=O.
What is the InChIKey of 2-butylcyclohexan-1-one;ethene?
The InChIKey is YJJKCAOXUFMAOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O.C2H4/c1-2-3-6-9-7-4-5-8-10(9)11;1-2/h9H,2-8H2,1H3;1-2H2.
What are the key properties of 2-butylcyclohexan-1-one;ethene?
2-butylcyclohexan-1-one;ethene has a molecular weight of 182.31 g/mol, XLogP of 3.74, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylcyclohexan-1-one;ethene is sourced from PubChem (CID 174843360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).