C31H21NO — CID 174843676
1H-azepine;hexacyclo[12.11.0.02,11.05,10.015,23.017,22]pentacosa-1,3,5,7,10,12,14,16,18,20,22,24-dodecaen-9-one (PubChem CID 174843676) has the molecular formula C31H21NO and a molecular weight of 423.52 g/mol. Its IUPAC name is 1H-azepine;hexacyclo[12.11.0.02,11.05,10.015,23.017,22]pentacosa-1,3,5,7,10,12,14,16,18,20,22,24-dodecaen-9-one.
| Compound Name | 1H-azepine;hexacyclo[12.11.0.02,11.05,10.015,23.017,22]pentacosa-1,3,5,7,10,12,14,16,18,20,22,24-dodecaen-9-one |
|---|---|
| PubChem CID | 174843676 |
| Molecular Formula | C31H21NO |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 1H-azepine;hexacyclo[12.11.0.02,11.05,10.015,23.017,22]pentacosa-1,3,5,7,10,12,14,16,18,20,22,24-dodecaen-9-one |
| SMILES | C1=CC=CNC=C1.O=C1C=CC=c2ccc3c(ccc4c5c(ccc43)=c3ccccc3=C5)c21 |
| InChI | InChI=1S/C25H14O.C6H7N/c26-24-7-3-5-15-8-9-20-19-11-10-18-17-6-2-1-4-16(17)14-23(18)21(19)12-13-22(20)25(15)24;1-2-4-6-7-5-3-1/h1-14H;1-7H |
| InChIKey | NXQMNRJHVAHJMO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|