About 1,2-dimethyl-2H-pyridine-3,6-dione
1,2-dimethyl-2H-pyridine-3,6-dione (PubChem CID 174843898) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is 1,2-dimethyl-2H-pyridine-3,6-dione.
Molecular Properties
| Compound Name | 1,2-dimethyl-2H-pyridine-3,6-dione |
| PubChem CID | 174843898 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 1,2-dimethyl-2H-pyridine-3,6-dione |
| SMILES | CC1C(=O)C=CC(=O)N1C |
| InChI | InChI=1S/C7H9NO2/c1-5-6(9)3-4-7(10)8(5)2/h3-5H,1-2H3 |
| InChIKey | BYNMDVHKJMYIMY-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-dimethyl-2H-pyridine-3,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-2H-pyridine-3,6-dione?
The IUPAC name of 1,2-dimethyl-2H-pyridine-3,6-dione (CID 174843898) is 1,2-dimethyl-2H-pyridine-3,6-dione.
What is the SMILES notation for 1,2-dimethyl-2H-pyridine-3,6-dione?
The canonical SMILES for 1,2-dimethyl-2H-pyridine-3,6-dione is CC1C(=O)C=CC(=O)N1C.
What is the InChIKey of 1,2-dimethyl-2H-pyridine-3,6-dione?
The InChIKey is BYNMDVHKJMYIMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c1-5-6(9)3-4-7(10)8(5)2/h3-5H,1-2H3.
What are the key properties of 1,2-dimethyl-2H-pyridine-3,6-dione?
1,2-dimethyl-2H-pyridine-3,6-dione has a molecular weight of 139.15 g/mol, XLogP of -0.03, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-2H-pyridine-3,6-dione is sourced from PubChem (CID 174843898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).