About azane;hydron;3-methoxydioxiran-3-ol
azane;hydron;3-methoxydioxiran-3-ol (PubChem CID 174843968) has the molecular formula C2H8NO4+
and a molecular weight of 110.09 g/mol. Its IUPAC name is azane;hydron;3-methoxydioxiran-3-ol.
Molecular Properties
| Compound Name | azane;hydron;3-methoxydioxiran-3-ol |
| PubChem CID | 174843968 |
| Molecular Formula | C2H8NO4+ |
| Molecular Weight | 110.09 g/mol |
| Exact Mass | 110.04 |
| IUPAC Name | azane;hydron;3-methoxydioxiran-3-ol |
| SMILES | COC1(O)OO1.N.[H+] |
| InChI | InChI=1S/C2H4O4.H3N/c1-4-2(3)5-6-2;/h3H,1H3;1H3/p+1 |
| InChIKey | YIGROYKRDNYUCU-UHFFFAOYSA-O |
| XLogP | -0.53 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.09 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze azane;hydron;3-methoxydioxiran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;hydron;3-methoxydioxiran-3-ol?
The IUPAC name of azane;hydron;3-methoxydioxiran-3-ol (CID 174843968) is azane;hydron;3-methoxydioxiran-3-ol.
What is the SMILES notation for azane;hydron;3-methoxydioxiran-3-ol?
The canonical SMILES for azane;hydron;3-methoxydioxiran-3-ol is COC1(O)OO1.N.[H+].
What is the InChIKey of azane;hydron;3-methoxydioxiran-3-ol?
The InChIKey is YIGROYKRDNYUCU-UHFFFAOYSA-O. The full InChI is InChI=1S/C2H4O4.H3N/c1-4-2(3)5-6-2;/h3H,1H3;1H3/p+1.
What are the key properties of azane;hydron;3-methoxydioxiran-3-ol?
azane;hydron;3-methoxydioxiran-3-ol has a molecular weight of 110.09 g/mol, XLogP of -0.53, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;hydron;3-methoxydioxiran-3-ol is sourced from PubChem (CID 174843968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).