C16H24N2 — CID 174844019
1-methyl-2,3,4,5-tetrakis(prop-2-enyl)-2H-imidazole (PubChem CID 174844019) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-methyl-2,3,4,5-tetrakis(prop-2-enyl)-2H-imidazole.
| Compound Name | 1-methyl-2,3,4,5-tetrakis(prop-2-enyl)-2H-imidazole |
|---|---|
| PubChem CID | 174844019 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 1-methyl-2,3,4,5-tetrakis(prop-2-enyl)-2H-imidazole |
| SMILES | C=CCC1=C(CC=C)N(CC=C)C(CC=C)N1C |
| InChI | InChI=1S/C16H24N2/c1-6-10-14-15(11-7-2)18(13-9-4)16(12-8-3)17(14)5/h6-9,16H,1-4,10-13H2,5H3 |
| InChIKey | RIEDQTBZISRXJZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|