About 4-ethoxyimidazol-2-one;formaldehyde;urea
4-ethoxyimidazol-2-one;formaldehyde;urea (PubChem CID 174844419) has the molecular formula C7H12N4O4
and a molecular weight of 216.20 g/mol. Its IUPAC name is 4-ethoxyimidazol-2-one;formaldehyde;urea.
Molecular Properties
| Compound Name | 4-ethoxyimidazol-2-one;formaldehyde;urea |
| PubChem CID | 174844419 |
| Molecular Formula | C7H12N4O4 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 4-ethoxyimidazol-2-one;formaldehyde;urea |
| SMILES | C=O.CCOC1=NC(=O)N=C1.NC(N)=O |
| InChI | InChI=1S/C5H6N2O2.CH4N2O.CH2O/c1-2-9-4-3-6-5(8)7-4;2-1(3)4;1-2/h3H,2H2,1H3;(H4,2,3,4);1H2 |
| InChIKey | XYTBEGZEBBRREG-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 137.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-ethoxyimidazol-2-one;formaldehyde;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxyimidazol-2-one;formaldehyde;urea?
The IUPAC name of 4-ethoxyimidazol-2-one;formaldehyde;urea (CID 174844419) is 4-ethoxyimidazol-2-one;formaldehyde;urea.
What is the SMILES notation for 4-ethoxyimidazol-2-one;formaldehyde;urea?
The canonical SMILES for 4-ethoxyimidazol-2-one;formaldehyde;urea is C=O.CCOC1=NC(=O)N=C1.NC(N)=O.
What is the InChIKey of 4-ethoxyimidazol-2-one;formaldehyde;urea?
The InChIKey is XYTBEGZEBBRREG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2.CH4N2O.CH2O/c1-2-9-4-3-6-5(8)7-4;2-1(3)4;1-2/h3H,2H2,1H3;(H4,2,3,4);1H2.
What are the key properties of 4-ethoxyimidazol-2-one;formaldehyde;urea?
4-ethoxyimidazol-2-one;formaldehyde;urea has a molecular weight of 216.20 g/mol, XLogP of -0.54, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxyimidazol-2-one;formaldehyde;urea is sourced from PubChem (CID 174844419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).