About 1H-phenalene;propanoic acid
1H-phenalene;propanoic acid (PubChem CID 174844804) has the molecular formula C16H16O2
and a molecular weight of 240.30 g/mol. Its IUPAC name is 1H-phenalene;propanoic acid.
Molecular Properties
| Compound Name | 1H-phenalene;propanoic acid |
| PubChem CID | 174844804 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 1H-phenalene;propanoic acid |
| SMILES | C1=Cc2cccc3cccc(c23)C1.CCC(=O)O |
| InChI | InChI=1S/C13H10.C3H6O2/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12;1-2-3(4)5/h1-8H,9H2;2H2,1H3,(H,4,5) |
| InChIKey | AYYNZQATRRSHKB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-phenalene;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-phenalene;propanoic acid?
The IUPAC name of 1H-phenalene;propanoic acid (CID 174844804) is 1H-phenalene;propanoic acid.
What is the SMILES notation for 1H-phenalene;propanoic acid?
The canonical SMILES for 1H-phenalene;propanoic acid is C1=Cc2cccc3cccc(c23)C1.CCC(=O)O.
What is the InChIKey of 1H-phenalene;propanoic acid?
The InChIKey is AYYNZQATRRSHKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C3H6O2/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12;1-2-3(4)5/h1-8H,9H2;2H2,1H3,(H,4,5).
What are the key properties of 1H-phenalene;propanoic acid?
1H-phenalene;propanoic acid has a molecular weight of 240.30 g/mol, XLogP of 3.89, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-phenalene;propanoic acid is sourced from PubChem (CID 174844804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).