About cyclobutanol;1-(2-hydroxyethyl)imidazolidin-2-one
cyclobutanol;1-(2-hydroxyethyl)imidazolidin-2-one (PubChem CID 174844984) has the molecular formula C9H18N2O3
and a molecular weight of 202.25 g/mol. Its IUPAC name is cyclobutanol;1-(2-hydroxyethyl)imidazolidin-2-one.
Molecular Properties
| Compound Name | cyclobutanol;1-(2-hydroxyethyl)imidazolidin-2-one |
| PubChem CID | 174844984 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | cyclobutanol;1-(2-hydroxyethyl)imidazolidin-2-one |
| SMILES | O=C1NCCN1CCO.OC1CCC1 |
| InChI | InChI=1S/C5H10N2O2.C4H8O/c8-4-3-7-2-1-6-5(7)9;5-4-2-1-3-4/h8H,1-4H2,(H,6,9);4-5H,1-3H2 |
| InChIKey | KIJDKQBXFXXHFQ-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclobutanol;1-(2-hydroxyethyl)imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutanol;1-(2-hydroxyethyl)imidazolidin-2-one?
The IUPAC name of cyclobutanol;1-(2-hydroxyethyl)imidazolidin-2-one (CID 174844984) is cyclobutanol;1-(2-hydroxyethyl)imidazolidin-2-one.
What is the SMILES notation for cyclobutanol;1-(2-hydroxyethyl)imidazolidin-2-one?
The canonical SMILES for cyclobutanol;1-(2-hydroxyethyl)imidazolidin-2-one is O=C1NCCN1CCO.OC1CCC1.
What is the InChIKey of cyclobutanol;1-(2-hydroxyethyl)imidazolidin-2-one?
The InChIKey is KIJDKQBXFXXHFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O2.C4H8O/c8-4-3-7-2-1-6-5(7)9;5-4-2-1-3-4/h8H,1-4H2,(H,6,9);4-5H,1-3H2.
What are the key properties of cyclobutanol;1-(2-hydroxyethyl)imidazolidin-2-one?
cyclobutanol;1-(2-hydroxyethyl)imidazolidin-2-one has a molecular weight of 202.25 g/mol, XLogP of -0.46, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutanol;1-(2-hydroxyethyl)imidazolidin-2-one is sourced from PubChem (CID 174844984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).