About benzene;benzo[e][1]benzothiole
benzene;benzo[e][1]benzothiole (PubChem CID 174845416) has the molecular formula C18H14S
and a molecular weight of 262.38 g/mol. Its IUPAC name is benzene;benzo[e][1]benzothiole.
Molecular Properties
| Compound Name | benzene;benzo[e][1]benzothiole |
| PubChem CID | 174845416 |
| Molecular Formula | C18H14S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | benzene;benzo[e][1]benzothiole |
| SMILES | c1ccc2c(c1)ccc1sccc12.c1ccccc1 |
| InChI | InChI=1S/C12H8S.C6H6/c1-2-4-10-9(3-1)5-6-12-11(10)7-8-13-12;1-2-4-6-5-3-1/h1-8H;1-6H |
| InChIKey | VPVUZTXGNYHUKI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzene;benzo[e][1]benzothiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;benzo[e][1]benzothiole?
The IUPAC name of benzene;benzo[e][1]benzothiole (CID 174845416) is benzene;benzo[e][1]benzothiole.
What is the SMILES notation for benzene;benzo[e][1]benzothiole?
The canonical SMILES for benzene;benzo[e][1]benzothiole is c1ccc2c(c1)ccc1sccc12.c1ccccc1.
What is the InChIKey of benzene;benzo[e][1]benzothiole?
The InChIKey is VPVUZTXGNYHUKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8S.C6H6/c1-2-4-10-9(3-1)5-6-12-11(10)7-8-13-12;1-2-4-6-5-3-1/h1-8H;1-6H.
What are the key properties of benzene;benzo[e][1]benzothiole?
benzene;benzo[e][1]benzothiole has a molecular weight of 262.38 g/mol, XLogP of 5.74, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;benzo[e][1]benzothiole is sourced from PubChem (CID 174845416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).