About adamantane;oct-1-ene
adamantane;oct-1-ene (PubChem CID 174845491) has the molecular formula C18H32
and a molecular weight of 248.45 g/mol. Its IUPAC name is adamantane;oct-1-ene.
Molecular Properties
| Compound Name | adamantane;oct-1-ene |
| PubChem CID | 174845491 |
| Molecular Formula | C18H32 |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | adamantane;oct-1-ene |
| SMILES | C1C2CC3CC1CC(C2)C3.C=CCCCCCC |
| InChI | InChI=1S/C10H16.C8H16/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-3-5-7-8-6-4-2/h7-10H,1-6H2;3H,1,4-8H2,2H3 |
| InChIKey | NSMBHMOJJCBHLB-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze adamantane;oct-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane;oct-1-ene?
The IUPAC name of adamantane;oct-1-ene (CID 174845491) is adamantane;oct-1-ene.
What is the SMILES notation for adamantane;oct-1-ene?
The canonical SMILES for adamantane;oct-1-ene is C1C2CC3CC1CC(C2)C3.C=CCCCCCC.
What is the InChIKey of adamantane;oct-1-ene?
The InChIKey is NSMBHMOJJCBHLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.C8H16/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-3-5-7-8-6-4-2/h7-10H,1-6H2;3H,1,4-8H2,2H3.
What are the key properties of adamantane;oct-1-ene?
adamantane;oct-1-ene has a molecular weight of 248.45 g/mol, XLogP of 5.98, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane;oct-1-ene is sourced from PubChem (CID 174845491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).