About 2-hydroxyethyl(trimethyl)azanium;phenylphosphane
2-hydroxyethyl(trimethyl)azanium;phenylphosphane (PubChem CID 174845713) has the molecular formula C11H21NOP+
and a molecular weight of 214.27 g/mol. Its IUPAC name is 2-hydroxyethyl(trimethyl)azanium;phenylphosphane.
Molecular Properties
| Compound Name | 2-hydroxyethyl(trimethyl)azanium;phenylphosphane |
| PubChem CID | 174845713 |
| Molecular Formula | C11H21NOP+ |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 2-hydroxyethyl(trimethyl)azanium;phenylphosphane |
| SMILES | C[N+](C)(C)CCO.Pc1ccccc1 |
| InChI | InChI=1S/C6H7P.C5H14NO/c7-6-4-2-1-3-5-6;1-6(2,3)4-5-7/h1-5H,7H2;7H,4-5H2,1-3H3/q;+1 |
| InChIKey | PITRFACJMUFYEK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl(trimethyl)azanium;phenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl(trimethyl)azanium;phenylphosphane?
The IUPAC name of 2-hydroxyethyl(trimethyl)azanium;phenylphosphane (CID 174845713) is 2-hydroxyethyl(trimethyl)azanium;phenylphosphane.
What is the SMILES notation for 2-hydroxyethyl(trimethyl)azanium;phenylphosphane?
The canonical SMILES for 2-hydroxyethyl(trimethyl)azanium;phenylphosphane is C[N+](C)(C)CCO.Pc1ccccc1.
What is the InChIKey of 2-hydroxyethyl(trimethyl)azanium;phenylphosphane?
The InChIKey is PITRFACJMUFYEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7P.C5H14NO/c7-6-4-2-1-3-5-6;1-6(2,3)4-5-7/h1-5H,7H2;7H,4-5H2,1-3H3/q;+1.
What are the key properties of 2-hydroxyethyl(trimethyl)azanium;phenylphosphane?
2-hydroxyethyl(trimethyl)azanium;phenylphosphane has a molecular weight of 214.27 g/mol, XLogP of 0.87, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl(trimethyl)azanium;phenylphosphane is sourced from PubChem (CID 174845713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).