C28H39N3O4 — CID 174845997
[2-(carbamoyloxymethyl)-2,3-dimethylpentyl] carbamate;N-methyl-1-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)methanamine (PubChem CID 174845997) has the molecular formula C28H39N3O4 and a molecular weight of 481.64 g/mol. Its IUPAC name is [2-(carbamoyloxymethyl)-2,3-dimethylpentyl] carbamate;N-methyl-1-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)methanamine.
| Compound Name | [2-(carbamoyloxymethyl)-2,3-dimethylpentyl] carbamate;N-methyl-1-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)methanamine |
|---|---|
| PubChem CID | 174845997 |
| Molecular Formula | C28H39N3O4 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.29 |
| IUPAC Name | [2-(carbamoyloxymethyl)-2,3-dimethylpentyl] carbamate;N-methyl-1-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)methanamine |
| SMILES | CCC(C)C(C)(COC(N)=O)COC(N)=O.CNCC12CCC(c3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C18H19N.C10H20N2O4/c1-19-12-18-11-10-13(14-6-2-4-8-16(14)18)15-7-3-5-9-17(15)18;1-4-7(2)10(3,5-15-8(11)13)6-16-9(12)14/h2-9,13,19H,10-12H2,1H3;7H,4-6H2,1-3H3,(H2,11,13)(H2,12,14) |
| InChIKey | WJPPCFJAOPHWGV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |