About anthracene-1,2-dione;bromomethylbenzene
anthracene-1,2-dione;bromomethylbenzene (PubChem CID 174847048) has the molecular formula C21H15BrO2
and a molecular weight of 379.25 g/mol. Its IUPAC name is anthracene-1,2-dione;bromomethylbenzene.
Molecular Properties
| Compound Name | anthracene-1,2-dione;bromomethylbenzene |
| PubChem CID | 174847048 |
| Molecular Formula | C21H15BrO2 |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | anthracene-1,2-dione;bromomethylbenzene |
| SMILES | BrCc1ccccc1.O=C1C=Cc2cc3ccccc3cc2C1=O |
| InChI | InChI=1S/C14H8O2.C7H7Br/c15-13-6-5-11-7-9-3-1-2-4-10(9)8-12(11)14(13)16;8-6-7-4-2-1-3-5-7/h1-8H;1-5H,6H2 |
| InChIKey | YOYCSHYPKSZSER-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze anthracene-1,2-dione;bromomethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene-1,2-dione;bromomethylbenzene?
The IUPAC name of anthracene-1,2-dione;bromomethylbenzene (CID 174847048) is anthracene-1,2-dione;bromomethylbenzene.
What is the SMILES notation for anthracene-1,2-dione;bromomethylbenzene?
The canonical SMILES for anthracene-1,2-dione;bromomethylbenzene is BrCc1ccccc1.O=C1C=Cc2cc3ccccc3cc2C1=O.
What is the InChIKey of anthracene-1,2-dione;bromomethylbenzene?
The InChIKey is YOYCSHYPKSZSER-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8O2.C7H7Br/c15-13-6-5-11-7-9-3-1-2-4-10(9)8-12(11)14(13)16;8-6-7-4-2-1-3-5-7/h1-8H;1-5H,6H2.
What are the key properties of anthracene-1,2-dione;bromomethylbenzene?
anthracene-1,2-dione;bromomethylbenzene has a molecular weight of 379.25 g/mol, XLogP of 5.20, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene-1,2-dione;bromomethylbenzene is sourced from PubChem (CID 174847048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).