C23H22O3S — CID 174847205
thioxanthen-9-one;1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione (PubChem CID 174847205) has the molecular formula C23H22O3S and a molecular weight of 378.49 g/mol. Its IUPAC name is thioxanthen-9-one;1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione.
| Compound Name | thioxanthen-9-one;1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione |
|---|---|
| PubChem CID | 174847205 |
| Molecular Formula | C23H22O3S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | thioxanthen-9-one;1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione |
| SMILES | CC12CCC(C(=O)C1=O)C2(C)C.O=c1c2ccccc2sc2ccccc12 |
| InChI | InChI=1S/C13H8OS.C10H14O2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;1-9(2)6-4-5-10(9,3)8(12)7(6)11/h1-8H;6H,4-5H2,1-3H3 |
| InChIKey | TYXBMJUHKVUHTG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|