About butan-1-amine;1-[4-(1-phenylimidazol-2-yl)phenyl]cyclobutan-1-amine
butan-1-amine;1-[4-(1-phenylimidazol-2-yl)phenyl]cyclobutan-1-amine (PubChem CID 174847300) has the molecular formula C23H30N4
and a molecular weight of 362.52 g/mol. Its IUPAC name is butan-1-amine;1-[4-(1-phenylimidazol-2-yl)phenyl]cyclobutan-1-amine.
Molecular Properties
| Compound Name | butan-1-amine;1-[4-(1-phenylimidazol-2-yl)phenyl]cyclobutan-1-amine |
| PubChem CID | 174847300 |
| Molecular Formula | C23H30N4 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | butan-1-amine;1-[4-(1-phenylimidazol-2-yl)phenyl]cyclobutan-1-amine |
| SMILES | CCCCN.NC1(c2ccc(-c3nccn3-c3ccccc3)cc2)CCC1 |
| InChI | InChI=1S/C19H19N3.C4H11N/c20-19(11-4-12-19)16-9-7-15(8-10-16)18-21-13-14-22(18)17-5-2-1-3-6-17;1-2-3-4-5/h1-3,5-10,13-14H,4,11-12,20H2;2-5H2,1H3 |
| InChIKey | UKUJBSOTKIDEDI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze butan-1-amine;1-[4-(1-phenylimidazol-2-yl)phenyl]cyclobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-amine;1-[4-(1-phenylimidazol-2-yl)phenyl]cyclobutan-1-amine?
The IUPAC name of butan-1-amine;1-[4-(1-phenylimidazol-2-yl)phenyl]cyclobutan-1-amine (CID 174847300) is butan-1-amine;1-[4-(1-phenylimidazol-2-yl)phenyl]cyclobutan-1-amine.
What is the SMILES notation for butan-1-amine;1-[4-(1-phenylimidazol-2-yl)phenyl]cyclobutan-1-amine?
The canonical SMILES for butan-1-amine;1-[4-(1-phenylimidazol-2-yl)phenyl]cyclobutan-1-amine is CCCCN.NC1(c2ccc(-c3nccn3-c3ccccc3)cc2)CCC1.
What is the InChIKey of butan-1-amine;1-[4-(1-phenylimidazol-2-yl)phenyl]cyclobutan-1-amine?
The InChIKey is UKUJBSOTKIDEDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3.C4H11N/c20-19(11-4-12-19)16-9-7-15(8-10-16)18-21-13-14-22(18)17-5-2-1-3-6-17;1-2-3-4-5/h1-3,5-10,13-14H,4,11-12,20H2;2-5H2,1H3.
What are the key properties of butan-1-amine;1-[4-(1-phenylimidazol-2-yl)phenyl]cyclobutan-1-amine?
butan-1-amine;1-[4-(1-phenylimidazol-2-yl)phenyl]cyclobutan-1-amine has a molecular weight of 362.52 g/mol, XLogP of 4.62, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-amine;1-[4-(1-phenylimidazol-2-yl)phenyl]cyclobutan-1-amine is sourced from PubChem (CID 174847300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).