About 2-chloro-2-(3,3,3-trifluoropropylsulfonyl)acetonitrile
2-chloro-2-(3,3,3-trifluoropropylsulfonyl)acetonitrile (PubChem CID 174847331) has the molecular formula C5H5ClF3NO2S
and a molecular weight of 235.61 g/mol. Its IUPAC name is 2-chloro-2-(3,3,3-trifluoropropylsulfonyl)acetonitrile.
Molecular Properties
| Compound Name | 2-chloro-2-(3,3,3-trifluoropropylsulfonyl)acetonitrile |
| PubChem CID | 174847331 |
| Molecular Formula | C5H5ClF3NO2S |
| Molecular Weight | 235.61 g/mol |
| Exact Mass | 234.97 |
| IUPAC Name | 2-chloro-2-(3,3,3-trifluoropropylsulfonyl)acetonitrile |
| SMILES | N#CC(Cl)S(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C5H5ClF3NO2S/c6-4(3-10)13(11,12)2-1-5(7,8)9/h4H,1-2H2 |
| InChIKey | ZVLISYVITMGWJP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.61 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-2-(3,3,3-trifluoropropylsulfonyl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-2-(3,3,3-trifluoropropylsulfonyl)acetonitrile?
The IUPAC name of 2-chloro-2-(3,3,3-trifluoropropylsulfonyl)acetonitrile (CID 174847331) is 2-chloro-2-(3,3,3-trifluoropropylsulfonyl)acetonitrile.
What is the SMILES notation for 2-chloro-2-(3,3,3-trifluoropropylsulfonyl)acetonitrile?
The canonical SMILES for 2-chloro-2-(3,3,3-trifluoropropylsulfonyl)acetonitrile is N#CC(Cl)S(=O)(=O)CCC(F)(F)F.
What is the InChIKey of 2-chloro-2-(3,3,3-trifluoropropylsulfonyl)acetonitrile?
The InChIKey is ZVLISYVITMGWJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5ClF3NO2S/c6-4(3-10)13(11,12)2-1-5(7,8)9/h4H,1-2H2.
What are the key properties of 2-chloro-2-(3,3,3-trifluoropropylsulfonyl)acetonitrile?
2-chloro-2-(3,3,3-trifluoropropylsulfonyl)acetonitrile has a molecular weight of 235.61 g/mol, XLogP of 1.44, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-2-(3,3,3-trifluoropropylsulfonyl)acetonitrile is sourced from PubChem (CID 174847331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).