About 2-azidoethanesulfonamide;hydrofluoride
2-azidoethanesulfonamide;hydrofluoride (PubChem CID 174848166) has the molecular formula C2H7FN4O2S
and a molecular weight of 170.17 g/mol. Its IUPAC name is 2-azidoethanesulfonamide;hydrofluoride.
Molecular Properties
| Compound Name | 2-azidoethanesulfonamide;hydrofluoride |
| PubChem CID | 174848166 |
| Molecular Formula | C2H7FN4O2S |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.03 |
| IUPAC Name | 2-azidoethanesulfonamide;hydrofluoride |
| SMILES | F.[N-]=[N+]=NCCS(N)(=O)=O |
| InChI | InChI=1S/C2H6N4O2S.FH/c3-6-5-1-2-9(4,7)8;/h1-2H2,(H2,4,7,8);1H |
| InChIKey | LFMMINWBZUVKHK-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-azidoethanesulfonamide;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azidoethanesulfonamide;hydrofluoride?
The IUPAC name of 2-azidoethanesulfonamide;hydrofluoride (CID 174848166) is 2-azidoethanesulfonamide;hydrofluoride.
What is the SMILES notation for 2-azidoethanesulfonamide;hydrofluoride?
The canonical SMILES for 2-azidoethanesulfonamide;hydrofluoride is F.[N-]=[N+]=NCCS(N)(=O)=O.
What is the InChIKey of 2-azidoethanesulfonamide;hydrofluoride?
The InChIKey is LFMMINWBZUVKHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N4O2S.FH/c3-6-5-1-2-9(4,7)8;/h1-2H2,(H2,4,7,8);1H.
What are the key properties of 2-azidoethanesulfonamide;hydrofluoride?
2-azidoethanesulfonamide;hydrofluoride has a molecular weight of 170.17 g/mol, XLogP of -0.26, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azidoethanesulfonamide;hydrofluoride is sourced from PubChem (CID 174848166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).