amino nonaneperoxoate

C9H19NO3 — CID 174849727

IUPACamino nonaneperoxoate
SMILESCCCCCCCCC(=O)OON
InChIInChI=1S/C9H19NO3/c1-2-3-4-5-6-7-8-9(11)12-13-10/h2-8,10H2,1H3
InChIKeyBJZHQQZEVLRSBJ-UHFFFAOYSA-N
MW189.25 g/mol
LogP2.09
Rot. Bonds8

About amino nonaneperoxoate

amino nonaneperoxoate (PubChem CID 174849727) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is amino nonaneperoxoate.

Molecular Properties

Compound Nameamino nonaneperoxoate
PubChem CID174849727
Molecular FormulaC9H19NO3
Molecular Weight189.25 g/mol
Exact Mass189.14
IUPAC Nameamino nonaneperoxoate
SMILESCCCCCCCCC(=O)OON
InChIInChI=1S/C9H19NO3/c1-2-3-4-5-6-7-8-9(11)12-13-10/h2-8,10H2,1H3
InChIKeyBJZHQQZEVLRSBJ-UHFFFAOYSA-N
XLogP2.09
TPSA61.55 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.25
LogP ≤ 52.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze amino nonaneperoxoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of amino nonaneperoxoate?
The IUPAC name of amino nonaneperoxoate (CID 174849727) is amino nonaneperoxoate.
What is the SMILES notation for amino nonaneperoxoate?
The canonical SMILES for amino nonaneperoxoate is CCCCCCCCC(=O)OON.
What is the InChIKey of amino nonaneperoxoate?
The InChIKey is BJZHQQZEVLRSBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO3/c1-2-3-4-5-6-7-8-9(11)12-13-10/h2-8,10H2,1H3.
What are the key properties of amino nonaneperoxoate?
amino nonaneperoxoate has a molecular weight of 189.25 g/mol, XLogP of 2.09, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for amino nonaneperoxoate is sourced from PubChem (CID 174849727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).