C9H2Br6O4 — CID 174850078
4,5,6-tribromo-2-(tribromomethyl)benzene-1,3-dicarboxylic acid (PubChem CID 174850078) has the molecular formula C9H2Br6O4 and a molecular weight of 653.53 g/mol. Its IUPAC name is 4,5,6-tribromo-2-(tribromomethyl)benzene-1,3-dicarboxylic acid.
| Compound Name | 4,5,6-tribromo-2-(tribromomethyl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174850078 |
| Molecular Formula | C9H2Br6O4 |
| Molecular Weight | 653.53 g/mol |
| Exact Mass | 647.51 |
| IUPAC Name | 4,5,6-tribromo-2-(tribromomethyl)benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1c(Br)c(Br)c(Br)c(C(=O)O)c1C(Br)(Br)Br |
| InChI | InChI=1S/C9H2Br6O4/c10-4-1(7(16)17)3(9(13,14)15)2(8(18)19)5(11)6(4)12/h(H,16,17)(H,18,19) |
| InChIKey | UCINCDNDGCMYQT-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.53 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|