About [2-(2,3-dihydropyridin-4-yl)-5-fluorophenyl]methanol
[2-(2,3-dihydropyridin-4-yl)-5-fluorophenyl]methanol (PubChem CID 174850318) has the molecular formula C12H12FNO
and a molecular weight of 205.23 g/mol. Its IUPAC name is [2-(2,3-dihydropyridin-4-yl)-5-fluorophenyl]methanol.
Molecular Properties
| Compound Name | [2-(2,3-dihydropyridin-4-yl)-5-fluorophenyl]methanol |
| PubChem CID | 174850318 |
| Molecular Formula | C12H12FNO |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | [2-(2,3-dihydropyridin-4-yl)-5-fluorophenyl]methanol |
| SMILES | OCc1cc(F)ccc1C1=CC=NCC1 |
| InChI | InChI=1S/C12H12FNO/c13-11-1-2-12(10(7-11)8-15)9-3-5-14-6-4-9/h1-3,5,7,15H,4,6,8H2 |
| InChIKey | JQTDQBQJWGFOFI-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2-(2,3-dihydropyridin-4-yl)-5-fluorophenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,3-dihydropyridin-4-yl)-5-fluorophenyl]methanol?
The IUPAC name of [2-(2,3-dihydropyridin-4-yl)-5-fluorophenyl]methanol (CID 174850318) is [2-(2,3-dihydropyridin-4-yl)-5-fluorophenyl]methanol.
What is the SMILES notation for [2-(2,3-dihydropyridin-4-yl)-5-fluorophenyl]methanol?
The canonical SMILES for [2-(2,3-dihydropyridin-4-yl)-5-fluorophenyl]methanol is OCc1cc(F)ccc1C1=CC=NCC1.
What is the InChIKey of [2-(2,3-dihydropyridin-4-yl)-5-fluorophenyl]methanol?
The InChIKey is JQTDQBQJWGFOFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FNO/c13-11-1-2-12(10(7-11)8-15)9-3-5-14-6-4-9/h1-3,5,7,15H,4,6,8H2.
What are the key properties of [2-(2,3-dihydropyridin-4-yl)-5-fluorophenyl]methanol?
[2-(2,3-dihydropyridin-4-yl)-5-fluorophenyl]methanol has a molecular weight of 205.23 g/mol, XLogP of 2.18, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,3-dihydropyridin-4-yl)-5-fluorophenyl]methanol is sourced from PubChem (CID 174850318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).