About 5-fluoro-2,7-dimethoxy-2,3-dihydronaphthalene
5-fluoro-2,7-dimethoxy-2,3-dihydronaphthalene (PubChem CID 174850674) has the molecular formula C12H13FO2
and a molecular weight of 208.23 g/mol. Its IUPAC name is 5-fluoro-2,7-dimethoxy-2,3-dihydronaphthalene.
Molecular Properties
| Compound Name | 5-fluoro-2,7-dimethoxy-2,3-dihydronaphthalene |
| PubChem CID | 174850674 |
| Molecular Formula | C12H13FO2 |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 5-fluoro-2,7-dimethoxy-2,3-dihydronaphthalene |
| SMILES | COc1cc(F)c2c(c1)=CC(OC)CC=2 |
| InChI | InChI=1S/C12H13FO2/c1-14-9-3-4-11-8(5-9)6-10(15-2)7-12(11)13/h4-7,9H,3H2,1-2H3 |
| InChIKey | TWGMXFSNIBDIFF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-2,7-dimethoxy-2,3-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2,7-dimethoxy-2,3-dihydronaphthalene?
The IUPAC name of 5-fluoro-2,7-dimethoxy-2,3-dihydronaphthalene (CID 174850674) is 5-fluoro-2,7-dimethoxy-2,3-dihydronaphthalene.
What is the SMILES notation for 5-fluoro-2,7-dimethoxy-2,3-dihydronaphthalene?
The canonical SMILES for 5-fluoro-2,7-dimethoxy-2,3-dihydronaphthalene is COc1cc(F)c2c(c1)=CC(OC)CC=2.
What is the InChIKey of 5-fluoro-2,7-dimethoxy-2,3-dihydronaphthalene?
The InChIKey is TWGMXFSNIBDIFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FO2/c1-14-9-3-4-11-8(5-9)6-10(15-2)7-12(11)13/h4-7,9H,3H2,1-2H3.
What are the key properties of 5-fluoro-2,7-dimethoxy-2,3-dihydronaphthalene?
5-fluoro-2,7-dimethoxy-2,3-dihydronaphthalene has a molecular weight of 208.23 g/mol, XLogP of 0.81, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,7-dimethoxy-2,3-dihydronaphthalene is sourced from PubChem (CID 174850674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).