C19H18Cl2F2N2O2 — CID 17485080
(4-benzylpiperazin-1-yl)-[3,5-dichloro-2-(difluoromethoxy)phenyl]methanone (PubChem CID 17485080) has the molecular formula C19H18Cl2F2N2O2 and a molecular weight of 415.27 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-[3,5-dichloro-2-(difluoromethoxy)phenyl]methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-[3,5-dichloro-2-(difluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 17485080 |
| Molecular Formula | C19H18Cl2F2N2O2 |
| Molecular Weight | 415.27 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-[3,5-dichloro-2-(difluoromethoxy)phenyl]methanone |
| SMILES | O=C(c1cc(Cl)cc(Cl)c1OC(F)F)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H18Cl2F2N2O2/c20-14-10-15(17(16(21)11-14)27-19(22)23)18(26)25-8-6-24(7-9-25)12-13-4-2-1-3-5-13/h1-5,10-11,19H,6-9,12H2 |
| InChIKey | WEEHUVHQHFIYRJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.27 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |