About 2-(4-chlorophenyl)-4,5-diphenyl-1H-imidazole;phosphorosobenzene
2-(4-chlorophenyl)-4,5-diphenyl-1H-imidazole;phosphorosobenzene (PubChem CID 174850878) has the molecular formula C27H20ClN2OP
and a molecular weight of 454.90 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4,5-diphenyl-1H-imidazole;phosphorosobenzene.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-4,5-diphenyl-1H-imidazole;phosphorosobenzene |
| PubChem CID | 174850878 |
| Molecular Formula | C27H20ClN2OP |
| Molecular Weight | 454.90 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 2-(4-chlorophenyl)-4,5-diphenyl-1H-imidazole;phosphorosobenzene |
| SMILES | Clc1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc1.O=Pc1ccccc1 |
| InChI | InChI=1S/C21H15ClN2.C6H5OP/c22-18-13-11-17(12-14-18)21-23-19(15-7-3-1-4-8-15)20(24-21)16-9-5-2-6-10-16;7-8-6-4-2-1-3-5-6/h1-14H,(H,23,24);1-5H |
| InChIKey | WHGPZUQDPABJRH-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.90 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chlorophenyl)-4,5-diphenyl-1H-imidazole;phosphorosobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-4,5-diphenyl-1H-imidazole;phosphorosobenzene?
The IUPAC name of 2-(4-chlorophenyl)-4,5-diphenyl-1H-imidazole;phosphorosobenzene (CID 174850878) is 2-(4-chlorophenyl)-4,5-diphenyl-1H-imidazole;phosphorosobenzene.
What is the SMILES notation for 2-(4-chlorophenyl)-4,5-diphenyl-1H-imidazole;phosphorosobenzene?
The canonical SMILES for 2-(4-chlorophenyl)-4,5-diphenyl-1H-imidazole;phosphorosobenzene is Clc1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc1.O=Pc1ccccc1.
What is the InChIKey of 2-(4-chlorophenyl)-4,5-diphenyl-1H-imidazole;phosphorosobenzene?
The InChIKey is WHGPZUQDPABJRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15ClN2.C6H5OP/c22-18-13-11-17(12-14-18)21-23-19(15-7-3-1-4-8-15)20(24-21)16-9-5-2-6-10-16;7-8-6-4-2-1-3-5-6/h1-14H,(H,23,24);1-5H.
What are the key properties of 2-(4-chlorophenyl)-4,5-diphenyl-1H-imidazole;phosphorosobenzene?
2-(4-chlorophenyl)-4,5-diphenyl-1H-imidazole;phosphorosobenzene has a molecular weight of 454.90 g/mol, XLogP of 7.67, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-4,5-diphenyl-1H-imidazole;phosphorosobenzene is sourced from PubChem (CID 174850878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).