C13H14FNO5 — CID 174851123
2,3-dimethylbutanoyl 2-fluoro-4-nitrobenzoate (PubChem CID 174851123) has the molecular formula C13H14FNO5 and a molecular weight of 283.25 g/mol. Its IUPAC name is 2,3-dimethylbutanoyl 2-fluoro-4-nitrobenzoate.
| Compound Name | 2,3-dimethylbutanoyl 2-fluoro-4-nitrobenzoate |
|---|---|
| PubChem CID | 174851123 |
| Molecular Formula | C13H14FNO5 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2,3-dimethylbutanoyl 2-fluoro-4-nitrobenzoate |
| SMILES | CC(C)C(C)C(=O)OC(=O)c1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C13H14FNO5/c1-7(2)8(3)12(16)20-13(17)10-5-4-9(15(18)19)6-11(10)14/h4-8H,1-3H3 |
| InChIKey | GCYQCNCOSQDXJU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|