About hydroxy(trioxo)rhenium;morpholine
hydroxy(trioxo)rhenium;morpholine (PubChem CID 174851241) has the molecular formula C4H10NO5Re
and a molecular weight of 338.33 g/mol. Its IUPAC name is hydroxy(trioxo)rhenium;morpholine.
Molecular Properties
| Compound Name | hydroxy(trioxo)rhenium;morpholine |
| PubChem CID | 174851241 |
| Molecular Formula | C4H10NO5Re |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | hydroxy(trioxo)rhenium;morpholine |
| SMILES | C1COCCN1.O=[Re](=O)(=O)O |
| InChI | InChI=1S/C4H9NO.H2O.3O.Re/c1-3-6-4-2-5-1;;;;;/h5H,1-4H2;1H2;;;;/q;;;;;+1/p-1 |
| InChIKey | AODYCYIASDGPFX-UHFFFAOYSA-M |
| XLogP | -1.31 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze hydroxy(trioxo)rhenium;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy(trioxo)rhenium;morpholine?
The IUPAC name of hydroxy(trioxo)rhenium;morpholine (CID 174851241) is hydroxy(trioxo)rhenium;morpholine.
What is the SMILES notation for hydroxy(trioxo)rhenium;morpholine?
The canonical SMILES for hydroxy(trioxo)rhenium;morpholine is C1COCCN1.O=[Re](=O)(=O)O.
What is the InChIKey of hydroxy(trioxo)rhenium;morpholine?
The InChIKey is AODYCYIASDGPFX-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H9NO.H2O.3O.Re/c1-3-6-4-2-5-1;;;;;/h5H,1-4H2;1H2;;;;/q;;;;;+1/p-1.
What are the key properties of hydroxy(trioxo)rhenium;morpholine?
hydroxy(trioxo)rhenium;morpholine has a molecular weight of 338.33 g/mol, XLogP of -1.31, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy(trioxo)rhenium;morpholine is sourced from PubChem (CID 174851241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).