About (3-ethyl-8,8-dimethyl-7-oxonaphthalen-2-yl) trifluoromethanesulfonate
(3-ethyl-8,8-dimethyl-7-oxonaphthalen-2-yl) trifluoromethanesulfonate (PubChem CID 174851303) has the molecular formula C15H15F3O4S
and a molecular weight of 348.34 g/mol. Its IUPAC name is (3-ethyl-8,8-dimethyl-7-oxonaphthalen-2-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (3-ethyl-8,8-dimethyl-7-oxonaphthalen-2-yl) trifluoromethanesulfonate |
| PubChem CID | 174851303 |
| Molecular Formula | C15H15F3O4S |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | (3-ethyl-8,8-dimethyl-7-oxonaphthalen-2-yl) trifluoromethanesulfonate |
| SMILES | CCc1cc2c(cc1OS(=O)(=O)C(F)(F)F)C(C)(C)C(=O)C=C2 |
| InChI | InChI=1S/C15H15F3O4S/c1-4-9-7-10-5-6-13(19)14(2,3)11(10)8-12(9)22-23(20,21)15(16,17)18/h5-8H,4H2,1-3H3 |
| InChIKey | MLZOIURJDJHMGJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (3-ethyl-8,8-dimethyl-7-oxonaphthalen-2-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethyl-8,8-dimethyl-7-oxonaphthalen-2-yl) trifluoromethanesulfonate?
The IUPAC name of (3-ethyl-8,8-dimethyl-7-oxonaphthalen-2-yl) trifluoromethanesulfonate (CID 174851303) is (3-ethyl-8,8-dimethyl-7-oxonaphthalen-2-yl) trifluoromethanesulfonate.
What is the SMILES notation for (3-ethyl-8,8-dimethyl-7-oxonaphthalen-2-yl) trifluoromethanesulfonate?
The canonical SMILES for (3-ethyl-8,8-dimethyl-7-oxonaphthalen-2-yl) trifluoromethanesulfonate is CCc1cc2c(cc1OS(=O)(=O)C(F)(F)F)C(C)(C)C(=O)C=C2.
What is the InChIKey of (3-ethyl-8,8-dimethyl-7-oxonaphthalen-2-yl) trifluoromethanesulfonate?
The InChIKey is MLZOIURJDJHMGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F3O4S/c1-4-9-7-10-5-6-13(19)14(2,3)11(10)8-12(9)22-23(20,21)15(16,17)18/h5-8H,4H2,1-3H3.
What are the key properties of (3-ethyl-8,8-dimethyl-7-oxonaphthalen-2-yl) trifluoromethanesulfonate?
(3-ethyl-8,8-dimethyl-7-oxonaphthalen-2-yl) trifluoromethanesulfonate has a molecular weight of 348.34 g/mol, XLogP of 3.35, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethyl-8,8-dimethyl-7-oxonaphthalen-2-yl) trifluoromethanesulfonate is sourced from PubChem (CID 174851303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).