C13H28N2O5 — CID 174851375
bis((2S,3S)-2-amino-3-methylpentanoic acid);formaldehyde (PubChem CID 174851375) has the molecular formula C13H28N2O5 and a molecular weight of 292.38 g/mol. Its IUPAC name is bis((2S,3S)-2-amino-3-methylpentanoic acid);formaldehyde.
| Compound Name | bis((2S,3S)-2-amino-3-methylpentanoic acid);formaldehyde |
|---|---|
| PubChem CID | 174851375 |
| Molecular Formula | C13H28N2O5 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | bis((2S,3S)-2-amino-3-methylpentanoic acid);formaldehyde |
| SMILES | C=O.CC[C@H](C)[C@H](N)C(=O)O.CC[C@H](C)[C@H](N)C(=O)O |
| InChI | InChI=1S/2C6H13NO2.CH2O/c2*1-3-4(2)5(7)6(8)9;1-2/h2*4-5H,3,7H2,1-2H3,(H,8,9);1H2/t2*4-,5-;/m00./s1 |
| InChIKey | OHJSNZVMSRVSFZ-WFGSYIHQSA-N |
| XLogP | 0.70 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |