C19H17F — CID 174851530
(3R)-1-fluoro-3-methyl-2,3,4,5-tetrahydrochrysene (PubChem CID 174851530) has the molecular formula C19H17F and a molecular weight of 264.34 g/mol. Its IUPAC name is (3R)-1-fluoro-3-methyl-2,3,4,5-tetrahydrochrysene.
| Compound Name | (3R)-1-fluoro-3-methyl-2,3,4,5-tetrahydrochrysene |
|---|---|
| PubChem CID | 174851530 |
| Molecular Formula | C19H17F |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | (3R)-1-fluoro-3-methyl-2,3,4,5-tetrahydrochrysene |
| SMILES | C[C@H]1CC(F)=c2ccc3c(c2C1)CC=c1ccccc1=3 |
| InChI | InChI=1S/C19H17F/c1-12-10-18-16-7-6-13-4-2-3-5-14(13)15(16)8-9-17(18)19(20)11-12/h2-6,8-9,12H,7,10-11H2,1H3/t12-/m1/s1 |
| InChIKey | RRVUKMIIJBBWTI-GFCCVEGCSA-N |
| XLogP | 2.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |