About 2-chlorocyclohexa-2,5-diene-1,4-dione;hydron
2-chlorocyclohexa-2,5-diene-1,4-dione;hydron (PubChem CID 174851627) has the molecular formula C6H4ClO2+
and a molecular weight of 143.55 g/mol. Its IUPAC name is 2-chlorocyclohexa-2,5-diene-1,4-dione;hydron.
Molecular Properties
| Compound Name | 2-chlorocyclohexa-2,5-diene-1,4-dione;hydron |
| PubChem CID | 174851627 |
| Molecular Formula | C6H4ClO2+ |
| Molecular Weight | 143.55 g/mol |
| Exact Mass | 142.99 |
| IUPAC Name | 2-chlorocyclohexa-2,5-diene-1,4-dione;hydron |
| SMILES | O=C1C=CC(=O)C(Cl)=C1.[H+] |
| InChI | InChI=1S/C6H3ClO2/c7-5-3-4(8)1-2-6(5)9/h1-3H/p+1 |
| InChIKey | WOGWYSWDBYCVDY-UHFFFAOYSA-O |
| XLogP | 0.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.55 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorocyclohexa-2,5-diene-1,4-dione;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorocyclohexa-2,5-diene-1,4-dione;hydron?
The IUPAC name of 2-chlorocyclohexa-2,5-diene-1,4-dione;hydron (CID 174851627) is 2-chlorocyclohexa-2,5-diene-1,4-dione;hydron.
What is the SMILES notation for 2-chlorocyclohexa-2,5-diene-1,4-dione;hydron?
The canonical SMILES for 2-chlorocyclohexa-2,5-diene-1,4-dione;hydron is O=C1C=CC(=O)C(Cl)=C1.[H+].
What is the InChIKey of 2-chlorocyclohexa-2,5-diene-1,4-dione;hydron?
The InChIKey is WOGWYSWDBYCVDY-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H3ClO2/c7-5-3-4(8)1-2-6(5)9/h1-3H/p+1.
What are the key properties of 2-chlorocyclohexa-2,5-diene-1,4-dione;hydron?
2-chlorocyclohexa-2,5-diene-1,4-dione;hydron has a molecular weight of 143.55 g/mol, XLogP of 0.93, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorocyclohexa-2,5-diene-1,4-dione;hydron is sourced from PubChem (CID 174851627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).