About ethyl 3-pentadeca-6,8,10-trienyloxirane-2-carboxylate
ethyl 3-pentadeca-6,8,10-trienyloxirane-2-carboxylate (PubChem CID 174851869) has the molecular formula C20H32O3
and a molecular weight of 320.47 g/mol. Its IUPAC name is ethyl 3-pentadeca-6,8,10-trienyloxirane-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-pentadeca-6,8,10-trienyloxirane-2-carboxylate |
| PubChem CID | 174851869 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | ethyl 3-pentadeca-6,8,10-trienyloxirane-2-carboxylate |
| SMILES | CCCCC=CC=CC=CCCCCCC1OC1C(=O)OCC |
| InChI | InChI=1S/C20H32O3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(23-18)20(21)22-4-2/h7-12,18-19H,3-6,13-17H2,1-2H3 |
| InChIKey | JGNJLQLEWZUEGZ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-pentadeca-6,8,10-trienyloxirane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-pentadeca-6,8,10-trienyloxirane-2-carboxylate?
The IUPAC name of ethyl 3-pentadeca-6,8,10-trienyloxirane-2-carboxylate (CID 174851869) is ethyl 3-pentadeca-6,8,10-trienyloxirane-2-carboxylate.
What is the SMILES notation for ethyl 3-pentadeca-6,8,10-trienyloxirane-2-carboxylate?
The canonical SMILES for ethyl 3-pentadeca-6,8,10-trienyloxirane-2-carboxylate is CCCCC=CC=CC=CCCCCCC1OC1C(=O)OCC.
What is the InChIKey of ethyl 3-pentadeca-6,8,10-trienyloxirane-2-carboxylate?
The InChIKey is JGNJLQLEWZUEGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32O3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(23-18)20(21)22-4-2/h7-12,18-19H,3-6,13-17H2,1-2H3.
What are the key properties of ethyl 3-pentadeca-6,8,10-trienyloxirane-2-carboxylate?
ethyl 3-pentadeca-6,8,10-trienyloxirane-2-carboxylate has a molecular weight of 320.47 g/mol, XLogP of 5.13, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-pentadeca-6,8,10-trienyloxirane-2-carboxylate is sourced from PubChem (CID 174851869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).