About 4,4-bis(tert-butylperoxy)-3,6-dimethylcyclohexyne
4,4-bis(tert-butylperoxy)-3,6-dimethylcyclohexyne (PubChem CID 174851955) has the molecular formula C16H28O4
and a molecular weight of 284.40 g/mol. Its IUPAC name is 4,4-bis(tert-butylperoxy)-3,6-dimethylcyclohexyne.
Molecular Properties
| Compound Name | 4,4-bis(tert-butylperoxy)-3,6-dimethylcyclohexyne |
| PubChem CID | 174851955 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 4,4-bis(tert-butylperoxy)-3,6-dimethylcyclohexyne |
| SMILES | CC1C#CC(C)C(OOC(C)(C)C)(OOC(C)(C)C)C1 |
| InChI | InChI=1S/C16H28O4/c1-12-9-10-13(2)16(11-12,19-17-14(3,4)5)20-18-15(6,7)8/h12-13H,11H2,1-8H3 |
| InChIKey | WMMGCRXSWSIJTK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,4-bis(tert-butylperoxy)-3,6-dimethylcyclohexyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-bis(tert-butylperoxy)-3,6-dimethylcyclohexyne?
The IUPAC name of 4,4-bis(tert-butylperoxy)-3,6-dimethylcyclohexyne (CID 174851955) is 4,4-bis(tert-butylperoxy)-3,6-dimethylcyclohexyne.
What is the SMILES notation for 4,4-bis(tert-butylperoxy)-3,6-dimethylcyclohexyne?
The canonical SMILES for 4,4-bis(tert-butylperoxy)-3,6-dimethylcyclohexyne is CC1C#CC(C)C(OOC(C)(C)C)(OOC(C)(C)C)C1.
What is the InChIKey of 4,4-bis(tert-butylperoxy)-3,6-dimethylcyclohexyne?
The InChIKey is WMMGCRXSWSIJTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O4/c1-12-9-10-13(2)16(11-12,19-17-14(3,4)5)20-18-15(6,7)8/h12-13H,11H2,1-8H3.
What are the key properties of 4,4-bis(tert-butylperoxy)-3,6-dimethylcyclohexyne?
4,4-bis(tert-butylperoxy)-3,6-dimethylcyclohexyne has a molecular weight of 284.40 g/mol, XLogP of 3.86, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-bis(tert-butylperoxy)-3,6-dimethylcyclohexyne is sourced from PubChem (CID 174851955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).