About 1-ethylsulfonylpropane;prop-2-ene-1-sulfinate
1-ethylsulfonylpropane;prop-2-ene-1-sulfinate (PubChem CID 174852684) has the molecular formula C8H17O4S2-
and a molecular weight of 241.35 g/mol. Its IUPAC name is 1-ethylsulfonylpropane;prop-2-ene-1-sulfinate.
Molecular Properties
| Compound Name | 1-ethylsulfonylpropane;prop-2-ene-1-sulfinate |
| PubChem CID | 174852684 |
| Molecular Formula | C8H17O4S2- |
| Molecular Weight | 241.35 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 1-ethylsulfonylpropane;prop-2-ene-1-sulfinate |
| SMILES | C=CCS(=O)[O-].CCCS(=O)(=O)CC |
| InChI | InChI=1S/C5H12O2S.C3H6O2S/c1-3-5-8(6,7)4-2;1-2-3-6(4)5/h3-5H2,1-2H3;2H,1,3H2,(H,4,5)/p-1 |
| InChIKey | PUFRYOXEKCHSTE-UHFFFAOYSA-M |
| XLogP | 0.88 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1-ethylsulfonylpropane;prop-2-ene-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylsulfonylpropane;prop-2-ene-1-sulfinate?
The IUPAC name of 1-ethylsulfonylpropane;prop-2-ene-1-sulfinate (CID 174852684) is 1-ethylsulfonylpropane;prop-2-ene-1-sulfinate.
What is the SMILES notation for 1-ethylsulfonylpropane;prop-2-ene-1-sulfinate?
The canonical SMILES for 1-ethylsulfonylpropane;prop-2-ene-1-sulfinate is C=CCS(=O)[O-].CCCS(=O)(=O)CC.
What is the InChIKey of 1-ethylsulfonylpropane;prop-2-ene-1-sulfinate?
The InChIKey is PUFRYOXEKCHSTE-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H12O2S.C3H6O2S/c1-3-5-8(6,7)4-2;1-2-3-6(4)5/h3-5H2,1-2H3;2H,1,3H2,(H,4,5)/p-1.
What are the key properties of 1-ethylsulfonylpropane;prop-2-ene-1-sulfinate?
1-ethylsulfonylpropane;prop-2-ene-1-sulfinate has a molecular weight of 241.35 g/mol, XLogP of 0.88, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylsulfonylpropane;prop-2-ene-1-sulfinate is sourced from PubChem (CID 174852684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).