C13H19NO3 — CID 174853513
3,5-dimethylmorpholine;2-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 174853513) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 3,5-dimethylmorpholine;2-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 3,5-dimethylmorpholine;2-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 174853513 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 3,5-dimethylmorpholine;2-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=CC(=O)C=CC1=O.CC1COCC(C)N1 |
| InChI | InChI=1S/C7H6O2.C6H13NO/c1-5-4-6(8)2-3-7(5)9;1-5-3-8-4-6(2)7-5/h2-4H,1H3;5-7H,3-4H2,1-2H3 |
| InChIKey | UUZYLRPFKYJBGB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|