C19H20N4O2S — CID 17485381
N-(4-pyrrolidin-1-ylphenyl)-3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)propanamide (PubChem CID 17485381) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is N-(4-pyrrolidin-1-ylphenyl)-3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)propanamide.
| Compound Name | N-(4-pyrrolidin-1-ylphenyl)-3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)propanamide |
|---|---|
| PubChem CID | 17485381 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N-(4-pyrrolidin-1-ylphenyl)-3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)propanamide |
| SMILES | O=C(CCc1nc(-c2ccsc2)no1)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C19H20N4O2S/c24-17(7-8-18-21-19(22-25-18)14-9-12-26-13-14)20-15-3-5-16(6-4-15)23-10-1-2-11-23/h3-6,9,12-13H,1-2,7-8,10-11H2,(H,20,24) |
| InChIKey | KQLAVVYMIKWBFW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|