About butan-2-ylsilane;cyclopentylcyclopentane
butan-2-ylsilane;cyclopentylcyclopentane (PubChem CID 174854150) has the molecular formula C14H30Si
and a molecular weight of 226.48 g/mol. Its IUPAC name is butan-2-ylsilane;cyclopentylcyclopentane.
Molecular Properties
| Compound Name | butan-2-ylsilane;cyclopentylcyclopentane |
| PubChem CID | 174854150 |
| Molecular Formula | C14H30Si |
| Molecular Weight | 226.48 g/mol |
| Exact Mass | 226.21 |
| IUPAC Name | butan-2-ylsilane;cyclopentylcyclopentane |
| SMILES | C1CCC(C2CCCC2)C1.CCC(C)[SiH3] |
| InChI | InChI=1S/C10H18.C4H12Si/c1-2-6-9(5-1)10-7-3-4-8-10;1-3-4(2)5/h9-10H,1-8H2;4H,3H2,1-2,5H3 |
| InChIKey | MASXBGSOLXMAOH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butan-2-ylsilane;cyclopentylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ylsilane;cyclopentylcyclopentane?
The IUPAC name of butan-2-ylsilane;cyclopentylcyclopentane (CID 174854150) is butan-2-ylsilane;cyclopentylcyclopentane.
What is the SMILES notation for butan-2-ylsilane;cyclopentylcyclopentane?
The canonical SMILES for butan-2-ylsilane;cyclopentylcyclopentane is C1CCC(C2CCCC2)C1.CCC(C)[SiH3].
What is the InChIKey of butan-2-ylsilane;cyclopentylcyclopentane?
The InChIKey is MASXBGSOLXMAOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18.C4H12Si/c1-2-6-9(5-1)10-7-3-4-8-10;1-3-4(2)5/h9-10H,1-8H2;4H,3H2,1-2,5H3.
What are the key properties of butan-2-ylsilane;cyclopentylcyclopentane?
butan-2-ylsilane;cyclopentylcyclopentane has a molecular weight of 226.48 g/mol, XLogP of 3.94, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ylsilane;cyclopentylcyclopentane is sourced from PubChem (CID 174854150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).