C23H24Cl2N2O2 — CID 17485493
N-[1-(2,4-dichlorophenyl)ethyl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide (PubChem CID 17485493) has the molecular formula C23H24Cl2N2O2 and a molecular weight of 431.36 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)ethyl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide.
| Compound Name | N-[1-(2,4-dichlorophenyl)ethyl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17485493 |
| Molecular Formula | C23H24Cl2N2O2 |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)ethyl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide |
| SMILES | CC(NC(=O)C1CCN(C(=O)/C=C/c2ccccc2)CC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H24Cl2N2O2/c1-16(20-9-8-19(24)15-21(20)25)26-23(29)18-11-13-27(14-12-18)22(28)10-7-17-5-3-2-4-6-17/h2-10,15-16,18H,11-14H2,1H3,(H,26,29)/b10-7+ |
| InChIKey | KQXKHCVIIMSRHX-JXMROGBWSA-N |
| XLogP | 5.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|