C22H40N2O2 — CID 174854983
1-[(Z)-1-aminooctadec-9-enyl]pyrrolidine-2,5-dione (PubChem CID 174854983) has the molecular formula C22H40N2O2 and a molecular weight of 364.57 g/mol. Its IUPAC name is 1-[(Z)-1-aminooctadec-9-enyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[(Z)-1-aminooctadec-9-enyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 174854983 |
| Molecular Formula | C22H40N2O2 |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.31 |
| IUPAC Name | 1-[(Z)-1-aminooctadec-9-enyl]pyrrolidine-2,5-dione |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(N)N1C(=O)CCC1=O |
| InChI | InChI=1S/C22H40N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)24-21(25)18-19-22(24)26/h9-10,20H,2-8,11-19,23H2,1H3/b10-9- |
| InChIKey | NKMGBQCZQIOWAF-KTKRTIGZSA-N |
| XLogP | 5.46 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|